C31H29N3O3 — CID 42548093
(4R)-7,7-dimethyl-2-phenyl-4-(4-phenylmethoxyphenyl)-4,6,8,9-tetrahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 42548093) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is (4R)-7,7-dimethyl-2-phenyl-4-(4-phenylmethoxyphenyl)-4,6,8,9-tetrahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R)-7,7-dimethyl-2-phenyl-4-(4-phenylmethoxyphenyl)-4,6,8,9-tetrahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 42548093 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (4R)-7,7-dimethyl-2-phenyl-4-(4-phenylmethoxyphenyl)-4,6,8,9-tetrahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1[nH]n(-c3ccccc3)c(=O)c1[C@@H]2c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H29N3O3/c1-31(2)17-24-27(25(35)18-31)26(21-13-15-23(16-14-21)37-19-20-9-5-3-6-10-20)28-29(32-24)33-34(30(28)36)22-11-7-4-8-12-22/h3-16,26,32-33H,17-19H2,1-2H3/t26-/m1/s1 |
| InChIKey | WOWKMVNIAUZKNE-AREMUKBSSA-N |
| XLogP | 5.95 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |