C20H19N7O3 — CID 4255181
2-N,6-N,8-N-tris(furan-2-ylmethyl)-7H-purine-2,6,8-triamine (PubChem CID 4255181) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 2-N,6-N,8-N-tris(furan-2-ylmethyl)-7H-purine-2,6,8-triamine.
| Compound Name | 2-N,6-N,8-N-tris(furan-2-ylmethyl)-7H-purine-2,6,8-triamine |
|---|---|
| PubChem CID | 4255181 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-N,6-N,8-N-tris(furan-2-ylmethyl)-7H-purine-2,6,8-triamine |
| SMILES | c1coc(CNc2nc(NCc3ccco3)c3[nH]c(NCc4ccco4)nc3n2)c1 |
| InChI | InChI=1S/C20H19N7O3/c1-4-13(28-7-1)10-21-17-16-18(26-19(24-16)22-11-14-5-2-8-29-14)27-20(25-17)23-12-15-6-3-9-30-15/h1-9H,10-12H2,(H4,21,22,23,24,25,26,27) |
| InChIKey | YMMWVBHDWLGCGI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |