About (2,4-dimethyl-1,3-thiazol-5-yl) propanoate
(2,4-dimethyl-1,3-thiazol-5-yl) propanoate (PubChem CID 42552778) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl) propanoate.
Molecular Properties
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl) propanoate |
| PubChem CID | 42552778 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl) propanoate |
| SMILES | CCC(=O)Oc1sc(C)nc1C |
| InChI | InChI=1S/C8H11NO2S/c1-4-7(10)11-8-5(2)9-6(3)12-8/h4H2,1-3H3 |
| InChIKey | PEMGSWBNOOUPHK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,4-dimethyl-1,3-thiazol-5-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl) propanoate?
The IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl) propanoate (CID 42552778) is (2,4-dimethyl-1,3-thiazol-5-yl) propanoate.
What is the SMILES notation for (2,4-dimethyl-1,3-thiazol-5-yl) propanoate?
The canonical SMILES for (2,4-dimethyl-1,3-thiazol-5-yl) propanoate is CCC(=O)Oc1sc(C)nc1C.
What is the InChIKey of (2,4-dimethyl-1,3-thiazol-5-yl) propanoate?
The InChIKey is PEMGSWBNOOUPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-4-7(10)11-8-5(2)9-6(3)12-8/h4H2,1-3H3.
What are the key properties of (2,4-dimethyl-1,3-thiazol-5-yl) propanoate?
(2,4-dimethyl-1,3-thiazol-5-yl) propanoate has a molecular weight of 185.25 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-1,3-thiazol-5-yl) propanoate is sourced from PubChem (CID 42552778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).