About 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one
3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one (PubChem CID 42552936) has the molecular formula C11H14N3O4P
and a molecular weight of 283.22 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one.
Molecular Properties
| Compound Name | 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one |
| PubChem CID | 42552936 |
| Molecular Formula | C11H14N3O4P |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one |
| SMILES | CCOP(=O)(OCC)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C11H14N3O4P/c1-3-17-19(16,18-4-2)14-11(15)9-7-5-6-8-10(9)12-13-14/h5-8H,3-4H2,1-2H3 |
| InChIKey | IQRWMMIWGVPOBI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one?
The IUPAC name of 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one (CID 42552936) is 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one.
What is the SMILES notation for 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one?
The canonical SMILES for 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one is CCOP(=O)(OCC)n1nnc2ccccc2c1=O.
What is the InChIKey of 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one?
The InChIKey is IQRWMMIWGVPOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N3O4P/c1-3-17-19(16,18-4-2)14-11(15)9-7-5-6-8-10(9)12-13-14/h5-8H,3-4H2,1-2H3.
What are the key properties of 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one?
3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one has a molecular weight of 283.22 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphoryl-1,2,3-benzotriazin-4-one is sourced from PubChem (CID 42552936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).