About 3,5-dibromo-2,6-dimethoxypyridine
3,5-dibromo-2,6-dimethoxypyridine (PubChem CID 42553050) has the molecular formula C7H7Br2NO2
and a molecular weight of 296.95 g/mol. Its IUPAC name is 3,5-dibromo-2,6-dimethoxypyridine.
Molecular Properties
| Compound Name | 3,5-dibromo-2,6-dimethoxypyridine |
| PubChem CID | 42553050 |
| Molecular Formula | C7H7Br2NO2 |
| Molecular Weight | 296.95 g/mol |
| Exact Mass | 294.88 |
| IUPAC Name | 3,5-dibromo-2,6-dimethoxypyridine |
| SMILES | COc1nc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C7H7Br2NO2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,1-2H3 |
| InChIKey | SQWUBNSHUMRETN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromo-2,6-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2,6-dimethoxypyridine?
The IUPAC name of 3,5-dibromo-2,6-dimethoxypyridine (CID 42553050) is 3,5-dibromo-2,6-dimethoxypyridine.
What is the SMILES notation for 3,5-dibromo-2,6-dimethoxypyridine?
The canonical SMILES for 3,5-dibromo-2,6-dimethoxypyridine is COc1nc(OC)c(Br)cc1Br.
What is the InChIKey of 3,5-dibromo-2,6-dimethoxypyridine?
The InChIKey is SQWUBNSHUMRETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br2NO2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,1-2H3.
What are the key properties of 3,5-dibromo-2,6-dimethoxypyridine?
3,5-dibromo-2,6-dimethoxypyridine has a molecular weight of 296.95 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,6-dimethoxypyridine is sourced from PubChem (CID 42553050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).