About N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide
N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide (PubChem CID 42554329) has the molecular formula C16H22F3N3O3
and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide |
| PubChem CID | 42554329 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(C2CCCC2)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C16H22F3N3O3/c17-16(18,19)15(20-12(23)10-6-2-1-3-7-10)13(24)22(14(25)21-15)11-8-4-5-9-11/h10-11H,1-9H2,(H,20,23)(H,21,25)/t15-/m0/s1 |
| InChIKey | OCBMYUXKRRFYPA-HNNXBMFYSA-N |
| XLogP | 2.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide?
The IUPAC name of N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide (CID 42554329) is N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide is O=C(N[C@]1(C(F)(F)F)NC(=O)N(C2CCCC2)C1=O)C1CCCCC1.
What is the InChIKey of N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide?
The InChIKey is OCBMYUXKRRFYPA-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H22F3N3O3/c17-16(18,19)15(20-12(23)10-6-2-1-3-7-10)13(24)22(14(25)21-15)11-8-4-5-9-11/h10-11H,1-9H2,(H,20,23)(H,21,25)/t15-/m0/s1.
What are the key properties of N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide?
N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide has a molecular weight of 361.36 g/mol, XLogP of 2.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclohexanecarboxamide is sourced from PubChem (CID 42554329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).