About [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine
[(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine (PubChem CID 42556023) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine.
Molecular Properties
| Compound Name | [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine |
| PubChem CID | 42556023 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine |
| SMILES | NC[C@@H]1OCCc2sccc21 |
| InChI | InChI=1S/C8H11NOS/c9-5-7-6-2-4-11-8(6)1-3-10-7/h2,4,7H,1,3,5,9H2/t7-/m0/s1 |
| InChIKey | NMVKUIFBCHQTHO-ZETCQYMHSA-N |
| XLogP | 1.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine?
The IUPAC name of [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine (CID 42556023) is [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine.
What is the SMILES notation for [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine?
The canonical SMILES for [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine is NC[C@@H]1OCCc2sccc21.
What is the InChIKey of [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine?
The InChIKey is NMVKUIFBCHQTHO-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H11NOS/c9-5-7-6-2-4-11-8(6)1-3-10-7/h2,4,7H,1,3,5,9H2/t7-/m0/s1.
What are the key properties of [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine?
[(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine has a molecular weight of 169.25 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl]methanamine is sourced from PubChem (CID 42556023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).