About 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine
2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 4255605) has the molecular formula C14H21N3S2
and a molecular weight of 295.48 g/mol. Its IUPAC name is 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 4255605 |
| Molecular Formula | C14H21N3S2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCCSc1nc(N)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C14H21N3S2/c1-4-5-6-7-8-18-14-16-12(15)11-9(2)10(3)19-13(11)17-14/h4-8H2,1-3H3,(H2,15,16,17) |
| InChIKey | OBWHQAFOUMNRPO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (CID 4255605) is 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine is CCCCCCSc1nc(N)c2c(C)c(C)sc2n1.
What is the InChIKey of 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is OBWHQAFOUMNRPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3S2/c1-4-5-6-7-8-18-14-16-12(15)11-9(2)10(3)19-13(11)17-14/h4-8H2,1-3H3,(H2,15,16,17).
What are the key properties of 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 295.48 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylsulfanyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 4255605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).