C20H29ClN2O3 — CID 42557122
3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]propanamide (PubChem CID 42557122) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]propanamide.
| Compound Name | 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 42557122 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
| SMILES | O=C(CCC1CCN(Cc2cc(Cl)ccc2O)CC1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H29ClN2O3/c21-17-4-5-19(24)16(12-17)14-23-9-7-15(8-10-23)3-6-20(25)22-13-18-2-1-11-26-18/h4-5,12,15,18,24H,1-3,6-11,13-14H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | IXQXIWXTARJMEQ-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|