C9H15N5O4S — CID 4255992
2-acetamido-4-methylsulfonyl-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 4255992) has the molecular formula C9H15N5O4S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-acetamido-4-methylsulfonyl-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | 2-acetamido-4-methylsulfonyl-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 4255992 |
| Molecular Formula | C9H15N5O4S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-acetamido-4-methylsulfonyl-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | CC(=O)NC(CCS(C)(=O)=O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C9H15N5O4S/c1-6(15)12-7(3-4-19(2,17)18)8(16)13-9-10-5-11-14-9/h5,7H,3-4H2,1-2H3,(H,12,15)(H2,10,11,13,14,16) |
| InChIKey | BCJQFVBTGAXGKD-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |