About N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide
N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide (PubChem CID 42560685) has the molecular formula C9H13N3O4S2
and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 42560685 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C9H13N3O4S2/c1-7(13)11-9-10-6-8(17-9)18(14,15)12-2-4-16-5-3-12/h6H,2-5H2,1H3,(H,10,11,13) |
| InChIKey | BSGVACGFGCXGNA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide (CID 42560685) is N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide is CC(=O)Nc1ncc(S(=O)(=O)N2CCOCC2)s1.
What is the InChIKey of N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is BSGVACGFGCXGNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4S2/c1-7(13)11-9-10-6-8(17-9)18(14,15)12-2-4-16-5-3-12/h6H,2-5H2,1H3,(H,10,11,13).
What are the key properties of N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide?
N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 291.35 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-morpholin-4-ylsulfonyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 42560685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).