C18H20FNO3 — CID 42560933
(2R)-2-(4-fluorophenoxy)-N-[(4-methoxyphenyl)methyl]-N-methylpropanamide (PubChem CID 42560933) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenoxy)-N-[(4-methoxyphenyl)methyl]-N-methylpropanamide.
| Compound Name | (2R)-2-(4-fluorophenoxy)-N-[(4-methoxyphenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 42560933 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2R)-2-(4-fluorophenoxy)-N-[(4-methoxyphenyl)methyl]-N-methylpropanamide |
| SMILES | COc1ccc(CN(C)C(=O)[C@@H](C)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FNO3/c1-13(23-17-10-6-15(19)7-11-17)18(21)20(2)12-14-4-8-16(22-3)9-5-14/h4-11,13H,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | HYTLUHNRHORHSU-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |