C16H14ClF2NO2 — CID 42563597
2-chloro-4,5-difluoro-N-[(1S)-1-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 42563597) has the molecular formula C16H14ClF2NO2 and a molecular weight of 325.74 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[(1S)-1-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[(1S)-1-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 42563597 |
| Molecular Formula | C16H14ClF2NO2 |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[(1S)-1-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1cccc([C@H](C)NC(=O)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C16H14ClF2NO2/c1-9(10-4-3-5-11(6-10)22-2)20-16(21)12-7-14(18)15(19)8-13(12)17/h3-9H,1-2H3,(H,20,21)/t9-/m0/s1 |
| InChIKey | QEJKVYAELWDUJO-VIFPVBQESA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|