C13H19NO2S — CID 42563839
(3S)-N,N,2,2-tetramethyl-1,1-dioxo-3-phenylthietan-3-amine (PubChem CID 42563839) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (3S)-N,N,2,2-tetramethyl-1,1-dioxo-3-phenylthietan-3-amine.
| Compound Name | (3S)-N,N,2,2-tetramethyl-1,1-dioxo-3-phenylthietan-3-amine |
|---|---|
| PubChem CID | 42563839 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3S)-N,N,2,2-tetramethyl-1,1-dioxo-3-phenylthietan-3-amine |
| SMILES | CN(C)[C@@]1(c2ccccc2)CS(=O)(=O)C1(C)C |
| InChI | InChI=1S/C13H19NO2S/c1-12(2)13(14(3)4,10-17(12,15)16)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | CIOUANFPIMXUJW-CYBMUJFWSA-N |
| XLogP | 1.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |