C17H19FO6 — CID 42564020
dimethyl (1R,2S,3S,4S)-2-(2-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 42564020) has the molecular formula C17H19FO6 and a molecular weight of 338.33 g/mol. Its IUPAC name is dimethyl (1R,2S,3S,4S)-2-(2-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3S,4S)-2-(2-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 42564020 |
| Molecular Formula | C17H19FO6 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | dimethyl (1R,2S,3S,4S)-2-(2-fluorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)OC)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C17H19FO6/c1-17(22)8-11(19)13(15(20)23-2)12(14(17)16(21)24-3)9-6-4-5-7-10(9)18/h4-7,12-14,22H,8H2,1-3H3/t12-,13+,14-,17+/m1/s1 |
| InChIKey | GXGFXPWIXGOCLF-OEUWWYETSA-N |
| XLogP | 1.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|