About benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium
benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium (PubChem CID 4256414) has the molecular formula C17H24NO+
and a molecular weight of 258.38 g/mol. Its IUPAC name is benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium.
Molecular Properties
| Compound Name | benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
| PubChem CID | 4256414 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
| SMILES | CCOC1=C/C(=[NH+]\Cc2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23NO/c1-4-19-16-10-15(11-17(2,3)12-16)18-13-14-8-6-5-7-9-14/h5-10H,4,11-13H2,1-3H3/p+1/b18-15+ |
| InChIKey | FDBHOJZZJJUOKZ-OBGWFSINSA-O |
| XLogP | 2.45 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The IUPAC name of benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium (CID 4256414) is benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium.
What is the SMILES notation for benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The canonical SMILES for benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium is CCOC1=C/C(=[NH+]\Cc2ccccc2)CC(C)(C)C1.
What is the InChIKey of benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
The InChIKey is FDBHOJZZJJUOKZ-OBGWFSINSA-O. The full InChI is InChI=1S/C17H23NO/c1-4-19-16-10-15(11-17(2,3)12-16)18-13-14-8-6-5-7-9-14/h5-10H,4,11-13H2,1-3H3/p+1/b18-15+.
What are the key properties of benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium?
benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium has a molecular weight of 258.38 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium is sourced from PubChem (CID 4256414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).