C19H19ClFN3O — CID 42566877
4-chloro-2-[[[(1S)-1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]phenol (PubChem CID 42566877) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is 4-chloro-2-[[[(1S)-1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[[(1S)-1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 42566877 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-chloro-2-[[[(1S)-1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]phenol |
| SMILES | Cc1c([C@H](C)NCc2cc(Cl)ccc2O)cnn1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-12(22-10-14-8-15(20)6-7-19(14)25)18-11-23-24(13(18)2)17-5-3-4-16(21)9-17/h3-9,11-12,22,25H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | VSSMZQQKGDUHPV-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|