C16H20F3N3O2 — CID 42567517
1-[(3R)-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-3-propylurea (PubChem CID 42567517) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[(3R)-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-3-propylurea.
| Compound Name | 1-[(3R)-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-3-propylurea |
|---|---|
| PubChem CID | 42567517 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[(3R)-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H]1CC(=O)N(Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-2-7-20-15(24)21-12-8-14(23)22(10-12)9-11-5-3-4-6-13(11)16(17,18)19/h3-6,12H,2,7-10H2,1H3,(H2,20,21,24)/t12-/m1/s1 |
| InChIKey | GFHLMVXIWNLNSI-GFCCVEGCSA-N |
| XLogP | 2.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |