C16H19BrN2O — CID 42568678
1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 42568678) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 42568678 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCc2[nH]c3c(Br)cccc3c2C1 |
| InChI | InChI=1S/C16H19BrN2O/c1-16(2,3)15(20)19-8-7-13-11(9-19)10-5-4-6-12(17)14(10)18-13/h4-6,18H,7-9H2,1-3H3 |
| InChIKey | FZHZRDKLSZYLAC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|