C14H12ClF3N2O2 — CID 4256880
[5-(4-chlorophenyl)-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-cyclopropylmethanone (PubChem CID 4256880) has the molecular formula C14H12ClF3N2O2 and a molecular weight of 332.71 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-cyclopropylmethanone.
| Compound Name | [5-(4-chlorophenyl)-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 4256880 |
| Molecular Formula | C14H12ClF3N2O2 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [5-(4-chlorophenyl)-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1NC(c2ccc(Cl)cc2)=CC1(O)C(F)(F)F |
| InChI | InChI=1S/C14H12ClF3N2O2/c15-10-5-3-8(4-6-10)11-7-13(22,14(16,17)18)20(19-11)12(21)9-1-2-9/h3-7,9,19,22H,1-2H2 |
| InChIKey | XDARGLGWARRASA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |