C16H16N4O2 — CID 42568916
[3-(1H-indol-5-yl)-1,2,4-oxadiazol-5-yl]-piperidin-1-ylmethanone (PubChem CID 42568916) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is [3-(1H-indol-5-yl)-1,2,4-oxadiazol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-(1H-indol-5-yl)-1,2,4-oxadiazol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42568916 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [3-(1H-indol-5-yl)-1,2,4-oxadiazol-5-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1nc(-c2ccc3[nH]ccc3c2)no1)N1CCCCC1 |
| InChI | InChI=1S/C16H16N4O2/c21-16(20-8-2-1-3-9-20)15-18-14(19-22-15)12-4-5-13-11(10-12)6-7-17-13/h4-7,10,17H,1-3,8-9H2 |
| InChIKey | MKABSEHGZUPUBN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |