About 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide
2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide (PubChem CID 4256920) has the molecular formula C20H20N2S2
and a molecular weight of 352.53 g/mol. Its IUPAC name is 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide.
Molecular Properties
| Compound Name | 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide |
| PubChem CID | 4256920 |
| Molecular Formula | C20H20N2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide |
| SMILES | Cc1cc(C)c(CSc2ccccc2C)cc1C=C(C#N)C(N)=S |
| InChI | InChI=1S/C20H20N2S2/c1-13-6-4-5-7-19(13)24-12-18-10-16(14(2)8-15(18)3)9-17(11-21)20(22)23/h4-10H,12H2,1-3H3,(H2,22,23) |
| InChIKey | XBMZFKWBLJOSNU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide?
The IUPAC name of 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide (CID 4256920) is 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide.
What is the SMILES notation for 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide?
The canonical SMILES for 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide is Cc1cc(C)c(CSc2ccccc2C)cc1C=C(C#N)C(N)=S.
What is the InChIKey of 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide?
The InChIKey is XBMZFKWBLJOSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2S2/c1-13-6-4-5-7-19(13)24-12-18-10-16(14(2)8-15(18)3)9-17(11-21)20(22)23/h4-10H,12H2,1-3H3,(H2,22,23).
What are the key properties of 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide?
2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide has a molecular weight of 352.53 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-[2,4-dimethyl-5-[(2-methylphenyl)sulfanylmethyl]phenyl]prop-2-enethioamide is sourced from PubChem (CID 4256920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).