About 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide
2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide (PubChem CID 42569825) has the molecular formula C19H17FN2O2S
and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide |
| PubChem CID | 42569825 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cnc(-c2ccccc2F)s1)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C19H17FN2O2S/c20-17-4-2-1-3-16(17)19-21-12-15(25-19)11-18(24)22-14-7-5-13(6-8-14)9-10-23/h1-8,12,23H,9-11H2,(H,22,24) |
| InChIKey | FATRVJPNTMDKLH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide?
The IUPAC name of 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide (CID 42569825) is 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide.
What is the SMILES notation for 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide?
The canonical SMILES for 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide is O=C(Cc1cnc(-c2ccccc2F)s1)Nc1ccc(CCO)cc1.
What is the InChIKey of 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide?
The InChIKey is FATRVJPNTMDKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O2S/c20-17-4-2-1-3-16(17)19-21-12-15(25-19)11-18(24)22-14-7-5-13(6-8-14)9-10-23/h1-8,12,23H,9-11H2,(H,22,24).
What are the key properties of 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide?
2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide has a molecular weight of 356.42 g/mol, XLogP of 3.67, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluorophenyl)-1,3-thiazol-5-yl]-N-[4-(2-hydroxyethyl)phenyl]acetamide is sourced from PubChem (CID 42569825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).