C26H29ClN5O+ — CID 4257226
7-(3-chloro-4-methylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 4257226) has the molecular formula C26H29ClN5O+ and a molecular weight of 463.01 g/mol. Its IUPAC name is 7-(3-chloro-4-methylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(3-chloro-4-methylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4257226 |
| Molecular Formula | C26H29ClN5O+ |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 7-(3-chloro-4-methylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-n2cc(-c3ccccc3)c3c(NCCC[NH+]4CCOCC4)ncnc32)cc1Cl |
| InChI | InChI=1S/C26H28ClN5O/c1-19-8-9-21(16-23(19)27)32-17-22(20-6-3-2-4-7-20)24-25(29-18-30-26(24)32)28-10-5-11-31-12-14-33-15-13-31/h2-4,6-9,16-18H,5,10-15H2,1H3,(H,28,29,30)/p+1 |
| InChIKey | XEBKCEGPAGGIAS-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|