C19H14N2O3S — CID 42573141
(1R,10S,11S)-11-phenyl-8-oxa-12-thia-14,16-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione (PubChem CID 42573141) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is (1R,10S,11S)-11-phenyl-8-oxa-12-thia-14,16-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione.
| Compound Name | (1R,10S,11S)-11-phenyl-8-oxa-12-thia-14,16-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione |
|---|---|
| PubChem CID | 42573141 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (1R,10S,11S)-11-phenyl-8-oxa-12-thia-14,16-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-9,15-dione |
| SMILES | O=C1Oc2ccccc2[C@@H]2c3[nH]c(=O)[nH]c3S[C@H](c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C19H14N2O3S/c22-18-14-13(11-8-4-5-9-12(11)24-18)15-17(21-19(23)20-15)25-16(14)10-6-2-1-3-7-10/h1-9,13-14,16H,(H2,20,21,23)/t13-,14+,16+/m0/s1 |
| InChIKey | HAPQGUQVGIEUHM-SQWLQELKSA-N |
| XLogP | 3.22 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|