About (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide
(2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide (PubChem CID 42574253) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide.
Molecular Properties
| Compound Name | (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide |
| PubChem CID | 42574253 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide |
| SMILES | Cc1cnn(C[C@@H](C)/C(N)=N/O)c1 |
| InChI | InChI=1S/C8H14N4O/c1-6-3-10-12(4-6)5-7(2)8(9)11-13/h3-4,7,13H,5H2,1-2H3,(H2,9,11)/t7-/m1/s1 |
| InChIKey | CCNIVSZRAZZPIO-SSDOTTSWSA-N |
| XLogP | 0.57 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide?
The IUPAC name of (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide (CID 42574253) is (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide.
What is the SMILES notation for (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide?
The canonical SMILES for (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide is Cc1cnn(C[C@@H](C)/C(N)=N/O)c1.
What is the InChIKey of (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide?
The InChIKey is CCNIVSZRAZZPIO-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14N4O/c1-6-3-10-12(4-6)5-7(2)8(9)11-13/h3-4,7,13H,5H2,1-2H3,(H2,9,11)/t7-/m1/s1.
What are the key properties of (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide?
(2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide has a molecular weight of 182.23 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N'-hydroxy-2-methyl-3-(4-methylpyrazol-1-yl)propanimidamide is sourced from PubChem (CID 42574253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).