C9H14F3N3 — CID 42574565
(2R)-2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine (PubChem CID 42574565) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is (2R)-2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine.
| Compound Name | (2R)-2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 42574565 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2R)-2-methyl-3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propan-1-amine |
| SMILES | Cc1cc(C(F)(F)F)n(C[C@H](C)CN)n1 |
| InChI | InChI=1S/C9H14F3N3/c1-6(4-13)5-15-8(9(10,11)12)3-7(2)14-15/h3,6H,4-5,13H2,1-2H3/t6-/m1/s1 |
| InChIKey | KXBCPRSVJPVCNI-ZCFIWIBFSA-N |
| XLogP | 1.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |