About 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine
7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 4257529) has the molecular formula C26H29N5O2
and a molecular weight of 443.55 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 4257529 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-n2cc(-c3ccccc3)c3c(NCCCN4CCOCC4)ncnc32)cc1 |
| InChI | InChI=1S/C26H29N5O2/c1-32-22-10-8-21(9-11-22)31-18-23(20-6-3-2-4-7-20)24-25(28-19-29-26(24)31)27-12-5-13-30-14-16-33-17-15-30/h2-4,6-11,18-19H,5,12-17H2,1H3,(H,27,28,29) |
| InChIKey | TUUBGTDIDADIPM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (CID 4257529) is 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is COc1ccc(-n2cc(-c3ccccc3)c3c(NCCCN4CCOCC4)ncnc32)cc1.
What is the InChIKey of 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is TUUBGTDIDADIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5O2/c1-32-22-10-8-21(9-11-22)31-18-23(20-6-3-2-4-7-20)24-25(28-19-29-26(24)31)27-12-5-13-30-14-16-33-17-15-30/h2-4,6-11,18-19H,5,12-17H2,1H3,(H,27,28,29).
What are the key properties of 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 443.55 g/mol, XLogP of 4.23, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 4257529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).