About N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide
N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide (PubChem CID 4257651) has the molecular formula C19H20FN3O4
and a molecular weight of 373.38 g/mol. Its IUPAC name is N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide |
| PubChem CID | 4257651 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=C(C)CC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H20FN3O4/c1-12(8-18(24)21-15-6-4-14(20)5-7-15)22-23-19(25)13-9-16(26-2)11-17(10-13)27-3/h4-7,9-11H,8H2,1-3H3,(H,21,24)(H,23,25) |
| InChIKey | CIDTWFOBJOEDGX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide?
The IUPAC name of N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide (CID 4257651) is N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide.
What is the SMILES notation for N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide?
The canonical SMILES for N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide is COc1cc(OC)cc(C(=O)NN=C(C)CC(=O)Nc2ccc(F)cc2)c1.
What is the InChIKey of N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide?
The InChIKey is CIDTWFOBJOEDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O4/c1-12(8-18(24)21-15-6-4-14(20)5-7-15)22-23-19(25)13-9-16(26-2)11-17(10-13)27-3/h4-7,9-11H,8H2,1-3H3,(H,21,24)(H,23,25).
What are the key properties of N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide?
N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide has a molecular weight of 373.38 g/mol, XLogP of 2.98, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-3,5-dimethoxybenzamide is sourced from PubChem (CID 4257651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).