About N-(4-methoxyphenyl)-2,4,6-trinitroaniline
N-(4-methoxyphenyl)-2,4,6-trinitroaniline (PubChem CID 4257825) has the molecular formula C13H10N4O7
and a molecular weight of 334.24 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,4,6-trinitroaniline.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-2,4,6-trinitroaniline |
| PubChem CID | 4257825 |
| Molecular Formula | C13H10N4O7 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-(4-methoxyphenyl)-2,4,6-trinitroaniline |
| SMILES | COc1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10N4O7/c1-24-10-4-2-8(3-5-10)14-13-11(16(20)21)6-9(15(18)19)7-12(13)17(22)23/h2-7,14H,1H3 |
| InChIKey | AUASAZDUSWQUKB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 150.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxyphenyl)-2,4,6-trinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-2,4,6-trinitroaniline?
The IUPAC name of N-(4-methoxyphenyl)-2,4,6-trinitroaniline (CID 4257825) is N-(4-methoxyphenyl)-2,4,6-trinitroaniline.
What is the SMILES notation for N-(4-methoxyphenyl)-2,4,6-trinitroaniline?
The canonical SMILES for N-(4-methoxyphenyl)-2,4,6-trinitroaniline is COc1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of N-(4-methoxyphenyl)-2,4,6-trinitroaniline?
The InChIKey is AUASAZDUSWQUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O7/c1-24-10-4-2-8(3-5-10)14-13-11(16(20)21)6-9(15(18)19)7-12(13)17(22)23/h2-7,14H,1H3.
What are the key properties of N-(4-methoxyphenyl)-2,4,6-trinitroaniline?
N-(4-methoxyphenyl)-2,4,6-trinitroaniline has a molecular weight of 334.24 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-2,4,6-trinitroaniline is sourced from PubChem (CID 4257825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).