C13H10F3N3O2S — CID 42578402
11-propan-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 42578402) has the molecular formula C13H10F3N3O2S and a molecular weight of 329.30 g/mol. Its IUPAC name is 11-propan-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 11-propan-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 42578402 |
| Molecular Formula | C13H10F3N3O2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 11-propan-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | CC(C)c1cc(C(F)(F)F)c2c(n1)sc1c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C13H10F3N3O2S/c1-4(2)6-3-5(13(14,15)16)7-8-9(22-11(7)17-6)10(20)19-12(21)18-8/h3-4H,1-2H3,(H2,18,19,20,21) |
| InChIKey | RUMAMBPNWLPBET-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |