C29H34ClNOS — CID 42578424
N-[[(1R,4aS,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 42578424) has the molecular formula C29H34ClNOS and a molecular weight of 480.12 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 42578424 |
| Molecular Formula | C29H34ClNOS |
| Molecular Weight | 480.12 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)[C@@]1(C)CCC[C@@](C)(CNC(=O)c3sc4ccccc4c3Cl)[C@@H]1CC2 |
| InChI | InChI=1S/C29H34ClNOS/c1-18(2)20-11-10-19-12-13-24-28(3,14-7-15-29(24,4)22(19)16-20)17-31-27(32)26-25(30)21-8-5-6-9-23(21)33-26/h5-6,8-11,16,18,24H,7,12-15,17H2,1-4H3,(H,31,32)/t24-,28-,29+/m0/s1 |
| InChIKey | KJZLUKGAQLRODD-RVVSJWLRSA-N |
| XLogP | 8.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.12 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |