C18H9Cl2N5OS — CID 42581500
3-[3-(2,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-5-phenyl-1,2-oxazole (PubChem CID 42581500) has the molecular formula C18H9Cl2N5OS and a molecular weight of 414.28 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-5-phenyl-1,2-oxazole.
| Compound Name | 3-[3-(2,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 42581500 |
| Molecular Formula | C18H9Cl2N5OS |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 3-[3-(2,4-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-5-phenyl-1,2-oxazole |
| SMILES | Clc1ccc(-c2nnc3sc(-c4cc(-c5ccccc5)on4)nn23)c(Cl)c1 |
| InChI | InChI=1S/C18H9Cl2N5OS/c19-11-6-7-12(13(20)8-11)16-21-22-18-25(16)23-17(27-18)14-9-15(26-24-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | XNEGGNYIIZJLNX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |