C29H30N2O4S — CID 42583882
ethyl (3aR,7aR)-2-[[2-(1-benzyl-2-methylindol-3-yl)-2-oxoacetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate (PubChem CID 42583882) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is ethyl (3aR,7aR)-2-[[2-(1-benzyl-2-methylindol-3-yl)-2-oxoacetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (3aR,7aR)-2-[[2-(1-benzyl-2-methylindol-3-yl)-2-oxoacetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 42583882 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | ethyl (3aR,7aR)-2-[[2-(1-benzyl-2-methylindol-3-yl)-2-oxoacetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(NC(=O)C(=O)c2c(C)n(Cc3ccccc3)c3ccccc23)S[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C29H30N2O4S/c1-3-35-29(34)25-21-14-8-10-16-23(21)36-28(25)30-27(33)26(32)24-18(2)31(17-19-11-5-4-6-12-19)22-15-9-7-13-20(22)24/h4-7,9,11-13,15,21,23H,3,8,10,14,16-17H2,1-2H3,(H,30,33)/t21-,23+/m0/s1 |
| InChIKey | XUWGEMNTUQYOBE-JTHBVZDNSA-N |
| XLogP | 5.38 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|