C14H15ClFN3O2 — CID 42584308
(3R,7aS)-2-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-3,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,5-dione (PubChem CID 42584308) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is (3R,7aS)-2-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-3,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,5-dione.
| Compound Name | (3R,7aS)-2-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-3,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,5-dione |
|---|---|
| PubChem CID | 42584308 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (3R,7aS)-2-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-3,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,5-dione |
| SMILES | CN(C)[C@H]1N(c2ccc(F)c(Cl)c2)C(=O)[C@@H]2CCC(=O)N21 |
| InChI | InChI=1S/C14H15ClFN3O2/c1-17(2)14-18(8-3-4-10(16)9(15)7-8)13(21)11-5-6-12(20)19(11)14/h3-4,7,11,14H,5-6H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | BTPPIVIFIBWRNQ-FZMZJTMJSA-N |
| XLogP | 1.66 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |