C20H36N10S2 — CID 42584388
6-[8-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]octylsulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 42584388) has the molecular formula C20H36N10S2 and a molecular weight of 480.71 g/mol. Its IUPAC name is 6-[8-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]octylsulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[8-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]octylsulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42584388 |
| Molecular Formula | C20H36N10S2 |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 6-[8-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methylsulfanyl]octylsulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(CSCCCCCCCCSCc2nc(N)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C20H36N10S2/c1-29(2)19-25-15(23-17(21)27-19)13-31-11-9-7-5-6-8-10-12-32-14-16-24-18(22)28-20(26-16)30(3)4/h5-14H2,1-4H3,(H2,21,23,25,27)(H2,22,24,26,28) |
| InChIKey | UNSGFGAJXYUMHF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|