C20H35NO2 — CID 42584459
(2R)-1-(1-adamantyloxy)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 42584459) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (2R)-1-(1-adamantyloxy)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(1-adamantyloxy)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 42584459 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (2R)-1-(1-adamantyloxy)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@@H]1CCC[C@H](C)N1C[C@@H](O)COC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H35NO2/c1-14-4-3-5-15(2)21(14)12-19(22)13-23-20-9-16-6-17(10-20)8-18(7-16)11-20/h14-19,22H,3-13H2,1-2H3/t14-,15+,16?,17?,18?,19-,20?/m1/s1 |
| InChIKey | JKXCTIFAGZFWSE-HYCCEDHASA-N |
| XLogP | 3.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |