About (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol
(2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol (PubChem CID 42584478) has the molecular formula C13H26NO3+
and a molecular weight of 244.35 g/mol. Its IUPAC name is (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol |
| PubChem CID | 42584478 |
| Molecular Formula | C13H26NO3+ |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol |
| SMILES | C[C@H]1CCC[C@@H]1OC[C@@H](O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H25NO3/c1-11-3-2-4-13(11)17-10-12(15)9-14-5-7-16-8-6-14/h11-13,15H,2-10H2,1H3/p+1/t11-,12-,13-/m0/s1 |
| InChIKey | PTNLBEFQQFGPBE-AVGNSLFASA-O |
| XLogP | -0.53 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol?
The IUPAC name of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol (CID 42584478) is (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol.
What is the SMILES notation for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol?
The canonical SMILES for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol is C[C@H]1CCC[C@@H]1OC[C@@H](O)C[NH+]1CCOCC1.
What is the InChIKey of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol?
The InChIKey is PTNLBEFQQFGPBE-AVGNSLFASA-O. The full InChI is InChI=1S/C13H25NO3/c1-11-3-2-4-13(11)17-10-12(15)9-14-5-7-16-8-6-14/h11-13,15H,2-10H2,1H3/p+1/t11-,12-,13-/m0/s1.
What are the key properties of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol?
(2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol has a molecular weight of 244.35 g/mol, XLogP of -0.53, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-morpholin-4-ium-4-ylpropan-2-ol is sourced from PubChem (CID 42584478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).