About (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol
(2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 42584486) has the molecular formula C14H28NO2+
and a molecular weight of 242.38 g/mol. Its IUPAC name is (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol |
| PubChem CID | 42584486 |
| Molecular Formula | C14H28NO2+ |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | C[C@H]1CCC[C@@H]1OC[C@@H](O)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C14H27NO2/c1-12-6-5-7-14(12)17-11-13(16)10-15-8-3-2-4-9-15/h12-14,16H,2-11H2,1H3/p+1/t12-,13-,14-/m0/s1 |
| InChIKey | ZSEZJUFXRAHNSD-IHRRRGAJSA-O |
| XLogP | 0.62 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol?
The IUPAC name of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol (CID 42584486) is (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol.
What is the SMILES notation for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol?
The canonical SMILES for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol is C[C@H]1CCC[C@@H]1OC[C@@H](O)C[NH+]1CCCCC1.
What is the InChIKey of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol?
The InChIKey is ZSEZJUFXRAHNSD-IHRRRGAJSA-O. The full InChI is InChI=1S/C14H27NO2/c1-12-6-5-7-14(12)17-11-13(16)10-15-8-3-2-4-9-15/h12-14,16H,2-11H2,1H3/p+1/t12-,13-,14-/m0/s1.
What are the key properties of (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol?
(2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol has a molecular weight of 242.38 g/mol, XLogP of 0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(1S,2S)-2-methylcyclopentyl]oxy-3-piperidin-1-ium-1-ylpropan-2-ol is sourced from PubChem (CID 42584486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).