About 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one
3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 42585046) has the molecular formula C13H12N4O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| PubChem CID | 42585046 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | CCc1nnc2c(=O)n(-c3ccccc3)ccn12 |
| InChI | InChI=1S/C13H12N4O/c1-2-11-14-15-12-13(18)16(8-9-17(11)12)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | XHEQCFQYORQEFE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one?
The IUPAC name of 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one (CID 42585046) is 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
What is the SMILES notation for 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one?
The canonical SMILES for 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one is CCc1nnc2c(=O)n(-c3ccccc3)ccn12.
What is the InChIKey of 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one?
The InChIKey is XHEQCFQYORQEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O/c1-2-11-14-15-12-13(18)16(8-9-17(11)12)10-6-4-3-5-7-10/h3-9H,2H2,1H3.
What are the key properties of 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one?
3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one has a molecular weight of 240.27 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one is sourced from PubChem (CID 42585046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).