C13H16N2O2 — CID 42586488
(6S)-5,6-dimethyl-6-(2-phenylethyl)-3H-1,3,4-oxadiazin-2-one (PubChem CID 42586488) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (6S)-5,6-dimethyl-6-(2-phenylethyl)-3H-1,3,4-oxadiazin-2-one.
| Compound Name | (6S)-5,6-dimethyl-6-(2-phenylethyl)-3H-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 42586488 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (6S)-5,6-dimethyl-6-(2-phenylethyl)-3H-1,3,4-oxadiazin-2-one |
| SMILES | CC1=NNC(=O)O[C@@]1(C)CCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c1-10-13(2,17-12(16)15-14-10)9-8-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | XQPUETWVLCRNFJ-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |