About (3S)-1,1,3-trimethylpiperidin-1-ium-4-one
(3S)-1,1,3-trimethylpiperidin-1-ium-4-one (PubChem CID 42587055) has the molecular formula C8H16NO+
and a molecular weight of 142.22 g/mol. Its IUPAC name is (3S)-1,1,3-trimethylpiperidin-1-ium-4-one.
Molecular Properties
| Compound Name | (3S)-1,1,3-trimethylpiperidin-1-ium-4-one |
| PubChem CID | 42587055 |
| Molecular Formula | C8H16NO+ |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (3S)-1,1,3-trimethylpiperidin-1-ium-4-one |
| SMILES | C[C@H]1C[N+](C)(C)CCC1=O |
| InChI | InChI=1S/C8H16NO/c1-7-6-9(2,3)5-4-8(7)10/h7H,4-6H2,1-3H3/q+1/t7-/m0/s1 |
| InChIKey | KVYVNJNCBAMSKA-ZETCQYMHSA-N |
| XLogP | 0.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,1,3-trimethylpiperidin-1-ium-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,1,3-trimethylpiperidin-1-ium-4-one?
The IUPAC name of (3S)-1,1,3-trimethylpiperidin-1-ium-4-one (CID 42587055) is (3S)-1,1,3-trimethylpiperidin-1-ium-4-one.
What is the SMILES notation for (3S)-1,1,3-trimethylpiperidin-1-ium-4-one?
The canonical SMILES for (3S)-1,1,3-trimethylpiperidin-1-ium-4-one is C[C@H]1C[N+](C)(C)CCC1=O.
What is the InChIKey of (3S)-1,1,3-trimethylpiperidin-1-ium-4-one?
The InChIKey is KVYVNJNCBAMSKA-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16NO/c1-7-6-9(2,3)5-4-8(7)10/h7H,4-6H2,1-3H3/q+1/t7-/m0/s1.
What are the key properties of (3S)-1,1,3-trimethylpiperidin-1-ium-4-one?
(3S)-1,1,3-trimethylpiperidin-1-ium-4-one has a molecular weight of 142.22 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1,3-trimethylpiperidin-1-ium-4-one is sourced from PubChem (CID 42587055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).