C18H20F14N2O2 — CID 4258742
2,2,3,3,4,4,4-heptafluoro-N-[[5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1,3,3-trimethylcyclohexyl]methyl]butanamide (PubChem CID 4258742) has the molecular formula C18H20F14N2O2 and a molecular weight of 562.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[[5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1,3,3-trimethylcyclohexyl]methyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[[5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1,3,3-trimethylcyclohexyl]methyl]butanamide |
|---|---|
| PubChem CID | 4258742 |
| Molecular Formula | C18H20F14N2O2 |
| Molecular Weight | 562.34 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[[5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1,3,3-trimethylcyclohexyl]methyl]butanamide |
| SMILES | CC1(C)CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC(C)(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H20F14N2O2/c1-11(2)4-8(34-10(36)14(21,22)16(25,26)18(30,31)32)5-12(3,6-11)7-33-9(35)13(19,20)15(23,24)17(27,28)29/h8H,4-7H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | BSWAZZZBWQKTQY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|