About N-cyclopentyl-N'-propan-2-yloxamide
N-cyclopentyl-N'-propan-2-yloxamide (PubChem CID 4258804) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-cyclopentyl-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N'-propan-2-yloxamide |
| PubChem CID | 4258804 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-cyclopentyl-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H18N2O2/c1-7(2)11-9(13)10(14)12-8-5-3-4-6-8/h7-8H,3-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | BTWBCZVLBVOQCK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N'-propan-2-yloxamide?
The IUPAC name of N-cyclopentyl-N'-propan-2-yloxamide (CID 4258804) is N-cyclopentyl-N'-propan-2-yloxamide.
What is the SMILES notation for N-cyclopentyl-N'-propan-2-yloxamide?
The canonical SMILES for N-cyclopentyl-N'-propan-2-yloxamide is CC(C)NC(=O)C(=O)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-N'-propan-2-yloxamide?
The InChIKey is BTWBCZVLBVOQCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-7(2)11-9(13)10(14)12-8-5-3-4-6-8/h7-8H,3-6H2,1-2H3,(H,11,13)(H,12,14).
What are the key properties of N-cyclopentyl-N'-propan-2-yloxamide?
N-cyclopentyl-N'-propan-2-yloxamide has a molecular weight of 198.27 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N'-propan-2-yloxamide is sourced from PubChem (CID 4258804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).