C26H27ClN4O2 — CID 42589308
4-[(2R)-3-carbazol-9-yl-2-hydroxypropyl]-N-(4-chlorophenyl)piperazine-1-carboxamide (PubChem CID 42589308) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-[(2R)-3-carbazol-9-yl-2-hydroxypropyl]-N-(4-chlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2R)-3-carbazol-9-yl-2-hydroxypropyl]-N-(4-chlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42589308 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-[(2R)-3-carbazol-9-yl-2-hydroxypropyl]-N-(4-chlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCN(C[C@@H](O)Cn2c3ccccc3c3ccccc32)CC1 |
| InChI | InChI=1S/C26H27ClN4O2/c27-19-9-11-20(12-10-19)28-26(33)30-15-13-29(14-16-30)17-21(32)18-31-24-7-3-1-5-22(24)23-6-2-4-8-25(23)31/h1-12,21,32H,13-18H2,(H,28,33)/t21-/m1/s1 |
| InChIKey | UKJQQSCTCWJLPG-OAQYLSRUSA-N |
| XLogP | 4.66 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |