C18H17N3O4S2 — CID 42589431
(3aS,6aS)-3-(2-methylphenyl)-1-(4-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 42589431) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (3aS,6aS)-3-(2-methylphenyl)-1-(4-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aS,6aS)-3-(2-methylphenyl)-1-(4-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 42589431 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (3aS,6aS)-3-(2-methylphenyl)-1-(4-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | Cc1ccccc1N1C(=S)N(c2ccc([N+](=O)[O-])cc2)[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H17N3O4S2/c1-12-4-2-3-5-15(12)20-17-11-27(24,25)10-16(17)19(18(20)26)13-6-8-14(9-7-13)21(22)23/h2-9,16-17H,10-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | KILJAUPCAWJQHD-IAGOWNOFSA-N |
| XLogP | 2.68 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|