C18H15N5O4 — CID 42590493
(3S)-7'-amino-1,1',3'-trimethyl-2,2',4'-trioxospiro[indole-3,5'-pyrano[2,3-d]pyrimidine]-6'-carbonitrile (PubChem CID 42590493) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is (3S)-7'-amino-1,1',3'-trimethyl-2,2',4'-trioxospiro[indole-3,5'-pyrano[2,3-d]pyrimidine]-6'-carbonitrile.
| Compound Name | (3S)-7'-amino-1,1',3'-trimethyl-2,2',4'-trioxospiro[indole-3,5'-pyrano[2,3-d]pyrimidine]-6'-carbonitrile |
|---|---|
| PubChem CID | 42590493 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (3S)-7'-amino-1,1',3'-trimethyl-2,2',4'-trioxospiro[indole-3,5'-pyrano[2,3-d]pyrimidine]-6'-carbonitrile |
| SMILES | CN1C(=O)[C@]2(C(C#N)=C(N)Oc3c2c(=O)n(C)c(=O)n3C)c2ccccc21 |
| InChI | InChI=1S/C18H15N5O4/c1-21-11-7-5-4-6-9(11)18(16(21)25)10(8-19)13(20)27-15-12(18)14(24)22(2)17(26)23(15)3/h4-7H,20H2,1-3H3/t18-/m0/s1 |
| InChIKey | RLYDBVZRVKRQJL-SFHVURJKSA-N |
| XLogP | -0.57 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |