C29H24BrCl2N3O9 — CID 4259081
8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4259081) has the molecular formula C29H24BrCl2N3O9 and a molecular weight of 709.33 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4259081 |
| Molecular Formula | C29H24BrCl2N3O9 |
| Molecular Weight | 709.33 g/mol |
| Exact Mass | 707.01 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C3C2CC2(Cl)C(=O)N(CBr)C(=O)C12Cl |
| InChI | InChI=1S/C29H24BrCl2N3O9/c1-43-19-9-15(36)10-20(44-2)22(19)23-16-7-8-17-21(18(16)11-28(31)26(39)33(12-30)27(40)29(23,28)32)25(38)34(24(17)37)13-3-5-14(6-4-13)35(41)42/h3-7,9-10,17-18,21,23,36H,8,11-12H2,1-2H3 |
| InChIKey | MPUDKXSJHVJXCJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|