C12H11N3O3 — CID 4259167
2-nitro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one (PubChem CID 4259167) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-nitro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 2-nitro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 4259167 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-nitro-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc2n1CCCC2 |
| InChI | InChI=1S/C12H11N3O3/c16-12-9-7-8(15(17)18)4-5-10(9)13-11-3-1-2-6-14(11)12/h4-5,7H,1-3,6H2 |
| InChIKey | PTSFVRFRBZBCGS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|