C21H22FN5O — CID 42591846
[1-[(2-fluorophenyl)methyl]triazol-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 42591846) has the molecular formula C21H22FN5O and a molecular weight of 379.44 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]triazol-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(2-fluorophenyl)methyl]triazol-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42591846 |
| Molecular Formula | C21H22FN5O |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]triazol-4-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cn(Cc4ccccc4F)nn3)CC2)cc1 |
| InChI | InChI=1S/C21H22FN5O/c1-16-6-8-18(9-7-16)25-10-12-26(13-11-25)21(28)20-15-27(24-23-20)14-17-4-2-3-5-19(17)22/h2-9,15H,10-14H2,1H3 |
| InChIKey | PXMZPESPUCUNFI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|